C23H21FN2O6S — CID 15992124
ethyl 4-[[(4-fluorophenyl)methyl-(3-nitrophenyl)sulfonylamino]methyl]benzoate (PubChem CID 15992124) has the molecular formula C23H21FN2O6S and a molecular weight of 472.49 g/mol. Its IUPAC name is ethyl 4-[[(4-fluorophenyl)methyl-(3-nitrophenyl)sulfonylamino]methyl]benzoate.
| Compound Name | ethyl 4-[[(4-fluorophenyl)methyl-(3-nitrophenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 15992124 |
| Molecular Formula | C23H21FN2O6S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | ethyl 4-[[(4-fluorophenyl)methyl-(3-nitrophenyl)sulfonylamino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN(Cc2ccc(F)cc2)S(=O)(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H21FN2O6S/c1-2-32-23(27)19-10-6-17(7-11-19)15-25(16-18-8-12-20(24)13-9-18)33(30,31)22-5-3-4-21(14-22)26(28)29/h3-14H,2,15-16H2,1H3 |
| InChIKey | JYFFDWIIWLIKMQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|