C31H39BrO6S — CID 11238965
[(1S)-1-[(1R,2S)-2-methyl-2-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]-5-oxocyclopentyl]-5-phenylmethoxypentyl] 2-bromopropanoate (PubChem CID 11238965) has the molecular formula C31H39BrO6S and a molecular weight of 619.62 g/mol. Its IUPAC name is [(1S)-1-[(1R,2S)-2-methyl-2-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]-5-oxocyclopentyl]-5-phenylmethoxypentyl] 2-bromopropanoate.
| Compound Name | [(1S)-1-[(1R,2S)-2-methyl-2-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]-5-oxocyclopentyl]-5-phenylmethoxypentyl] 2-bromopropanoate |
|---|---|
| PubChem CID | 11238965 |
| Molecular Formula | C31H39BrO6S |
| Molecular Weight | 619.62 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | [(1S)-1-[(1R,2S)-2-methyl-2-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]-5-oxocyclopentyl]-5-phenylmethoxypentyl] 2-bromopropanoate |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/C[C@]2(C)CCC(=O)[C@H]2[C@H](CCCCOCc2ccccc2)OC(=O)C(C)Br)cc1 |
| InChI | InChI=1S/C31H39BrO6S/c1-23-13-15-26(16-14-23)39(35,36)21-9-18-31(3)19-17-27(33)29(31)28(38-30(34)24(2)32)12-7-8-20-37-22-25-10-5-4-6-11-25/h4-6,9-11,13-16,21,24,28-29H,7-8,12,17-20,22H2,1-3H3/b21-9+/t24?,28-,29-,31+/m0/s1 |
| InChIKey | QFEDJQLGTKSNLV-GNLDOAJWSA-N |
| XLogP | 6.74 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.62 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|