C31H40O6S — CID 11226504
(1S,7S,7aR)-4a-hydroxy-4,7-dimethyl-7-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]-1-(4-phenylmethoxybutyl)-4,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one (PubChem CID 11226504) has the molecular formula C31H40O6S and a molecular weight of 540.72 g/mol. Its IUPAC name is (1S,7S,7aR)-4a-hydroxy-4,7-dimethyl-7-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]-1-(4-phenylmethoxybutyl)-4,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one.
| Compound Name | (1S,7S,7aR)-4a-hydroxy-4,7-dimethyl-7-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]-1-(4-phenylmethoxybutyl)-4,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 11226504 |
| Molecular Formula | C31H40O6S |
| Molecular Weight | 540.72 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | (1S,7S,7aR)-4a-hydroxy-4,7-dimethyl-7-[(E)-3-(4-methylphenyl)sulfonylprop-2-enyl]-1-(4-phenylmethoxybutyl)-4,5,6,7a-tetrahydro-1H-cyclopenta[c]pyran-3-one |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/C[C@]2(C)CCC3(O)C(C)C(=O)O[C@@H](CCCCOCc4ccccc4)[C@H]32)cc1 |
| InChI | InChI=1S/C31H40O6S/c1-23-13-15-26(16-14-23)38(34,35)21-9-17-30(3)18-19-31(33)24(2)29(32)37-27(28(30)31)12-7-8-20-36-22-25-10-5-4-6-11-25/h4-6,9-11,13-16,21,24,27-28,33H,7-8,12,17-20,22H2,1-3H3/b21-9+/t24?,27-,28-,30+,31?/m0/s1 |
| InChIKey | LSUKSSVIULYGLU-FXJPHRSDSA-N |
| XLogP | 5.77 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.72 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|