C33H38O8S — CID 45142179
diethyl (2S,3R,4R)-4-(4-methylphenyl)sulfonyl-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 45142179) has the molecular formula C33H38O8S and a molecular weight of 594.73 g/mol. Its IUPAC name is diethyl (2S,3R,4R)-4-(4-methylphenyl)sulfonyl-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl (2S,3R,4R)-4-(4-methylphenyl)sulfonyl-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 45142179 |
| Molecular Formula | C33H38O8S |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | diethyl (2S,3R,4R)-4-(4-methylphenyl)sulfonyl-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H](S(=O)(=O)c2ccc(C)cc2)[C@H](OCc2ccccc2)[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C33H38O8S/c1-4-39-31(34)33(32(35)40-5-2)20-29(42(36,37)27-18-16-24(3)17-19-27)30(41-22-26-14-10-7-11-15-26)28(33)23-38-21-25-12-8-6-9-13-25/h6-19,28-30H,4-5,20-23H2,1-3H3/t28-,29+,30+/m0/s1 |
| InChIKey | VCGIQYGZZPGAJW-FRXPANAUSA-N |
| XLogP | 5.07 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|