C28H30O11S — CID 16743845
methyl (1S,2S,3S,4S,5R,8R)-2,3-diacetyloxy-8-[(4-methylphenyl)sulfonylmethyl]-7-oxo-4-phenylmethoxy-6-oxabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 16743845) has the molecular formula C28H30O11S and a molecular weight of 574.60 g/mol. Its IUPAC name is methyl (1S,2S,3S,4S,5R,8R)-2,3-diacetyloxy-8-[(4-methylphenyl)sulfonylmethyl]-7-oxo-4-phenylmethoxy-6-oxabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl (1S,2S,3S,4S,5R,8R)-2,3-diacetyloxy-8-[(4-methylphenyl)sulfonylmethyl]-7-oxo-4-phenylmethoxy-6-oxabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 16743845 |
| Molecular Formula | C28H30O11S |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.15 |
| IUPAC Name | methyl (1S,2S,3S,4S,5R,8R)-2,3-diacetyloxy-8-[(4-methylphenyl)sulfonylmethyl]-7-oxo-4-phenylmethoxy-6-oxabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | COC(=O)[C@@]12C(=O)O[C@@H]([C@H](OCc3ccccc3)[C@@H](OC(C)=O)[C@H]1OC(C)=O)[C@@H]2CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H30O11S/c1-16-10-12-20(13-11-16)40(33,34)15-21-22-23(36-14-19-8-6-5-7-9-19)24(37-17(2)29)25(38-18(3)30)28(21,26(31)35-4)27(32)39-22/h5-13,21-25H,14-15H2,1-4H3/t21-,22+,23-,24+,25+,28-/m0/s1 |
| InChIKey | AWKIAZKRFZHBRV-KPMVRSIDSA-N |
| XLogP | 1.93 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|