C23H26O5S — CID 10501930
4-(4-methylphenyl)sulfonyl-6-phenylmethoxy-1-oxaspiro[4.5]decan-2-one (PubChem CID 10501930) has the molecular formula C23H26O5S and a molecular weight of 414.52 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-6-phenylmethoxy-1-oxaspiro[4.5]decan-2-one.
| Compound Name | 4-(4-methylphenyl)sulfonyl-6-phenylmethoxy-1-oxaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 10501930 |
| Molecular Formula | C23H26O5S |
| Molecular Weight | 414.52 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-6-phenylmethoxy-1-oxaspiro[4.5]decan-2-one |
| SMILES | Cc1ccc(S(=O)(=O)C2CC(=O)OC23CCCCC3OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26O5S/c1-17-10-12-19(13-11-17)29(25,26)21-15-22(24)28-23(21)14-6-5-9-20(23)27-16-18-7-3-2-4-8-18/h2-4,7-8,10-13,20-21H,5-6,9,14-16H2,1H3 |
| InChIKey | BDBKZAAJRISRNV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.52 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |