C24H26O7S — CID 72696816
methyl (2R,3R,3aS,6aR)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate (PubChem CID 72696816) has the molecular formula C24H26O7S and a molecular weight of 458.53 g/mol. Its IUPAC name is methyl (2R,3R,3aS,6aR)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate.
| Compound Name | methyl (2R,3R,3aS,6aR)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
|---|---|
| PubChem CID | 72696816 |
| Molecular Formula | C24H26O7S |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | methyl (2R,3R,3aS,6aR)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
| SMILES | COC(=O)C1=C(C)O[C@H]2O[C@H](COCc3ccccc3)[C@H](S(=O)(=O)c3ccc(C)cc3)[C@@H]12 |
| InChI | InChI=1S/C24H26O7S/c1-15-9-11-18(12-10-15)32(26,27)22-19(14-29-13-17-7-5-4-6-8-17)31-24-21(22)20(16(2)30-24)23(25)28-3/h4-12,19,21-22,24H,13-14H2,1-3H3/t19-,21-,22+,24+/m1/s1 |
| InChIKey | JOZSKUMWYNHBRC-VLHNPEIBSA-N |
| XLogP | 3.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |