C26H32O9S — CID 102295878
dimethyl 2-[(2S,3R,4R,5S,6R)-2-methoxy-6-methyl-5-(4-methylphenyl)sulfonyl-3-phenylmethoxyoxan-4-yl]propanedioate (PubChem CID 102295878) has the molecular formula C26H32O9S and a molecular weight of 520.60 g/mol. Its IUPAC name is dimethyl 2-[(2S,3R,4R,5S,6R)-2-methoxy-6-methyl-5-(4-methylphenyl)sulfonyl-3-phenylmethoxyoxan-4-yl]propanedioate.
| Compound Name | dimethyl 2-[(2S,3R,4R,5S,6R)-2-methoxy-6-methyl-5-(4-methylphenyl)sulfonyl-3-phenylmethoxyoxan-4-yl]propanedioate |
|---|---|
| PubChem CID | 102295878 |
| Molecular Formula | C26H32O9S |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | dimethyl 2-[(2S,3R,4R,5S,6R)-2-methoxy-6-methyl-5-(4-methylphenyl)sulfonyl-3-phenylmethoxyoxan-4-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H]1[C@@H](OCc2ccccc2)[C@@H](OC)O[C@H](C)[C@H]1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H32O9S/c1-16-11-13-19(14-12-16)36(29,30)23-17(2)35-26(33-5)22(34-15-18-9-7-6-8-10-18)20(23)21(24(27)31-3)25(28)32-4/h6-14,17,20-23,26H,15H2,1-5H3/t17-,20-,22-,23-,26+/m1/s1 |
| InChIKey | VRLYRTXWCRBOBY-UUBPLCSOSA-N |
| XLogP | 2.69 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|