C25H26O9S — CID 10481162
benzyl (2S,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 10481162) has the molecular formula C25H26O9S and a molecular weight of 502.54 g/mol. Its IUPAC name is benzyl (2S,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxane-2-carboxylate.
| Compound Name | benzyl (2S,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 10481162 |
| Molecular Formula | C25H26O9S |
| Molecular Weight | 502.54 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | benzyl (2S,3S,4S,5S,6R)-3,4,5-triacetyloxy-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](Sc2ccccc2)O[C@H](C(=O)OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H26O9S/c1-15(26)31-20-21(32-16(2)27)23(33-17(3)28)25(35-19-12-8-5-9-13-19)34-22(20)24(29)30-14-18-10-6-4-7-11-18/h4-13,20-23,25H,14H2,1-3H3/t20-,21-,22-,23-,25+/m0/s1 |
| InChIKey | CZXXLIMNDMPICB-IJELJUKBSA-N |
| XLogP | 3.04 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|