C33H26O8S — CID 15929772
[(2R,3R,4S,6S)-3,4-dibenzoyloxy-5-oxo-6-phenylsulfanyloxan-2-yl]methyl benzoate (PubChem CID 15929772) has the molecular formula C33H26O8S and a molecular weight of 582.63 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-3,4-dibenzoyloxy-5-oxo-6-phenylsulfanyloxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,6S)-3,4-dibenzoyloxy-5-oxo-6-phenylsulfanyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 15929772 |
| Molecular Formula | C33H26O8S |
| Molecular Weight | 582.63 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | [(2R,3R,4S,6S)-3,4-dibenzoyloxy-5-oxo-6-phenylsulfanyloxan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1O[C@@H](Sc2ccccc2)C(=O)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H26O8S/c34-27-29(41-32(37)24-17-9-3-10-18-24)28(40-31(36)23-15-7-2-8-16-23)26(21-38-30(35)22-13-5-1-6-14-22)39-33(27)42-25-19-11-4-12-20-25/h1-20,26,28-29,33H,21H2/t26-,28-,29-,33+/m1/s1 |
| InChIKey | BCYQDOJFMNJTMJ-SQBYSBBASA-N |
| XLogP | 5.38 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|