C39H34O8S — CID 5351228
2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate;(2,5-dimethylphenyl)-(4-methylphenyl)-phenylsulfanium (PubChem CID 5351228) has the molecular formula C39H34O8S and a molecular weight of 662.76 g/mol. Its IUPAC name is 2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate;(2,5-dimethylphenyl)-(4-methylphenyl)-phenylsulfanium.
| Compound Name | 2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate;(2,5-dimethylphenyl)-(4-methylphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 5351228 |
| Molecular Formula | C39H34O8S |
| Molecular Weight | 662.76 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | 2,3-dibenzoyloxy-4-hydroxy-4-oxobutanoate;(2,5-dimethylphenyl)-(4-methylphenyl)-phenylsulfanium |
| SMILES | Cc1ccc([S+](c2ccccc2)c2cc(C)ccc2C)cc1.O=C(OC(C(=O)[O-])C(OC(=O)c1ccccc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C21H21S.C18H14O8/c1-16-10-13-20(14-11-16)22(19-7-5-4-6-8-19)21-15-17(2)9-12-18(21)3;19-15(20)13(25-17(23)11-7-3-1-4-8-11)14(16(21)22)26-18(24)12-9-5-2-6-10-12/h4-15H,1-3H3;1-10,13-14H,(H,19,20)(H,21,22)/q+1;/p-1 |
| InChIKey | UPAYOWHZAHIRRV-UHFFFAOYSA-M |
| XLogP | 5.98 |
| TPSA | 130.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|