C35H30O9S — CID 11239018
methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfanyloxane-2-carboxylate (PubChem CID 11239018) has the molecular formula C35H30O9S and a molecular weight of 626.68 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 11239018 |
| Molecular Formula | C35H30O9S |
| Molecular Weight | 626.68 g/mol |
| Exact Mass | 626.16 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3,4,5-tribenzoyloxy-6-(4-methylphenyl)sulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Sc2ccc(C)cc2)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C35H30O9S/c1-22-18-20-26(21-19-22)45-35-30(43-33(38)25-16-10-5-11-17-25)28(42-32(37)24-14-8-4-9-15-24)27(29(44-35)34(39)40-2)41-31(36)23-12-6-3-7-13-23/h3-21,27-30,35H,1-2H3/t27-,28-,29-,30+,35-/m0/s1 |
| InChIKey | FBKLOKVCPIDGHM-QZEQSQFTSA-N |
| XLogP | 5.66 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|