C26H30O8 — CID 13325709
methyl (2S,3S,4S,5R,6S)-3-acetyloxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane-2-carboxylate (PubChem CID 13325709) has the molecular formula C26H30O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-3-acetyloxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-3-acetyloxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 13325709 |
| Molecular Formula | C26H30O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-3-acetyloxy-4,5-bis(phenylmethoxy)-6-prop-2-enoxyoxane-2-carboxylate |
| SMILES | C=CCO[C@H]1O[C@H](C(=O)OC)[C@@H](OC(C)=O)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H30O8/c1-4-15-30-26-24(32-17-20-13-9-6-10-14-20)21(31-16-19-11-7-5-8-12-19)22(33-18(2)27)23(34-26)25(28)29-3/h4-14,21-24,26H,1,15-17H2,2-3H3/t21-,22-,23-,24+,26-/m0/s1 |
| InChIKey | BARJYTRFLPSMDH-LSHRBJLDSA-N |
| XLogP | 3.19 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|