C23H26O6 — CID 10572937
methyl 2-[(2S,4S,5R,6R)-6-formyl-4,5-bis(phenylmethoxy)oxan-2-yl]acetate (PubChem CID 10572937) has the molecular formula C23H26O6 and a molecular weight of 398.45 g/mol. Its IUPAC name is methyl 2-[(2S,4S,5R,6R)-6-formyl-4,5-bis(phenylmethoxy)oxan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,4S,5R,6R)-6-formyl-4,5-bis(phenylmethoxy)oxan-2-yl]acetate |
|---|---|
| PubChem CID | 10572937 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | methyl 2-[(2S,4S,5R,6R)-6-formyl-4,5-bis(phenylmethoxy)oxan-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](C=O)O1 |
| InChI | InChI=1S/C23H26O6/c1-26-22(25)13-19-12-20(27-15-17-8-4-2-5-9-17)23(21(14-24)29-19)28-16-18-10-6-3-7-11-18/h2-11,14,19-21,23H,12-13,15-16H2,1H3/t19-,20-,21-,23+/m0/s1 |
| InChIKey | VQUSSGHTJVUHIS-VVSUKSJXSA-N |
| XLogP | 3.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|