C29H26O8S — CID 14520416
[(2R,3R,4S,6S)-3,4-dibenzoyloxy-6-ethylsulfanyl-5-oxooxan-2-yl]methyl benzoate (PubChem CID 14520416) has the molecular formula C29H26O8S and a molecular weight of 534.59 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-3,4-dibenzoyloxy-6-ethylsulfanyl-5-oxooxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3R,4S,6S)-3,4-dibenzoyloxy-6-ethylsulfanyl-5-oxooxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 14520416 |
| Molecular Formula | C29H26O8S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | [(2R,3R,4S,6S)-3,4-dibenzoyloxy-6-ethylsulfanyl-5-oxooxan-2-yl]methyl benzoate |
| SMILES | CCS[C@@H]1O[C@H](COC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C29H26O8S/c1-2-38-29-23(30)25(37-28(33)21-16-10-5-11-17-21)24(36-27(32)20-14-8-4-9-15-20)22(35-29)18-34-26(31)19-12-6-3-7-13-19/h3-17,22,24-25,29H,2,18H2,1H3/t22-,24-,25-,29+/m1/s1 |
| InChIKey | YAPFIHYTNDTVBM-UUUUBVMTSA-N |
| XLogP | 4.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|