C22H20O4S — CID 101033386
S-[(1S,2R,5S)-3-oxo-2-[(1R)-1-phenylethoxy]-8-oxabicyclo[3.2.1]oct-6-en-6-yl] benzenecarbothioate (PubChem CID 101033386) has the molecular formula C22H20O4S and a molecular weight of 380.47 g/mol. Its IUPAC name is S-[(1S,2R,5S)-3-oxo-2-[(1R)-1-phenylethoxy]-8-oxabicyclo[3.2.1]oct-6-en-6-yl] benzenecarbothioate.
| Compound Name | S-[(1S,2R,5S)-3-oxo-2-[(1R)-1-phenylethoxy]-8-oxabicyclo[3.2.1]oct-6-en-6-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 101033386 |
| Molecular Formula | C22H20O4S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | S-[(1S,2R,5S)-3-oxo-2-[(1R)-1-phenylethoxy]-8-oxabicyclo[3.2.1]oct-6-en-6-yl] benzenecarbothioate |
| SMILES | C[C@@H](O[C@H]1C(=O)C[C@@H]2O[C@H]1C=C2SC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20O4S/c1-14(15-8-4-2-5-9-15)25-21-17(23)12-18-20(13-19(21)26-18)27-22(24)16-10-6-3-7-11-16/h2-11,13-14,18-19,21H,12H2,1H3/t14-,18+,19+,21+/m1/s1 |
| InChIKey | RCFGYVUJDRUBKU-MMCAFHBRSA-N |
| XLogP | 4.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|