C18H22O5S — CID 11416817
[(2S,4R,5S,6S)-2-ethylsulfanyl-6-methyl-3-oxo-5-prop-2-enoxyoxan-4-yl] benzoate (PubChem CID 11416817) has the molecular formula C18H22O5S and a molecular weight of 350.44 g/mol. Its IUPAC name is [(2S,4R,5S,6S)-2-ethylsulfanyl-6-methyl-3-oxo-5-prop-2-enoxyoxan-4-yl] benzoate.
| Compound Name | [(2S,4R,5S,6S)-2-ethylsulfanyl-6-methyl-3-oxo-5-prop-2-enoxyoxan-4-yl] benzoate |
|---|---|
| PubChem CID | 11416817 |
| Molecular Formula | C18H22O5S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | [(2S,4R,5S,6S)-2-ethylsulfanyl-6-methyl-3-oxo-5-prop-2-enoxyoxan-4-yl] benzoate |
| SMILES | C=CCO[C@H]1[C@H](C)O[C@@H](SCC)C(=O)[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O5S/c1-4-11-21-15-12(3)22-18(24-5-2)14(19)16(15)23-17(20)13-9-7-6-8-10-13/h4,6-10,12,15-16,18H,1,5,11H2,2-3H3/t12-,15-,16-,18-/m0/s1 |
| InChIKey | VVJHLFCMPDSIHG-RPZXMPESSA-N |
| XLogP | 2.85 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|