C22H24O7S — CID 72980579
(5-benzoyloxy-6-ethylsulfanyl-3,4-dihydroxyoxan-2-yl)methyl benzoate (PubChem CID 72980579) has the molecular formula C22H24O7S and a molecular weight of 432.49 g/mol. Its IUPAC name is (5-benzoyloxy-6-ethylsulfanyl-3,4-dihydroxyoxan-2-yl)methyl benzoate.
| Compound Name | (5-benzoyloxy-6-ethylsulfanyl-3,4-dihydroxyoxan-2-yl)methyl benzoate |
|---|---|
| PubChem CID | 72980579 |
| Molecular Formula | C22H24O7S |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | (5-benzoyloxy-6-ethylsulfanyl-3,4-dihydroxyoxan-2-yl)methyl benzoate |
| SMILES | CCSC1OC(COC(=O)c2ccccc2)C(O)C(O)C1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24O7S/c1-2-30-22-19(29-21(26)15-11-7-4-8-12-15)18(24)17(23)16(28-22)13-27-20(25)14-9-5-3-6-10-14/h3-12,16-19,22-24H,2,13H2,1H3 |
| InChIKey | BTHPKSOPYUOXRK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |