C25H34O9S — CID 10006557
(2R,3R,4S,5R,6S)-2-[2-(benzenesulfonyl)ethyl]-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane (PubChem CID 10006557) has the molecular formula C25H34O9S and a molecular weight of 510.61 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-[2-(benzenesulfonyl)ethyl]-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane.
| Compound Name | (2R,3R,4S,5R,6S)-2-[2-(benzenesulfonyl)ethyl]-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 10006557 |
| Molecular Formula | C25H34O9S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-[2-(benzenesulfonyl)ethyl]-6-methoxy-4,5-bis(methoxymethoxy)-3-phenylmethoxyoxane |
| SMILES | COCO[C@@H]1[C@@H](OCOC)[C@@H](OC)O[C@H](CCS(=O)(=O)c2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H34O9S/c1-28-17-32-23-22(31-16-19-10-6-4-7-11-19)21(34-25(30-3)24(23)33-18-29-2)14-15-35(26,27)20-12-8-5-9-13-20/h4-13,21-25H,14-18H2,1-3H3/t21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | ZUBOQIBMQQXZJQ-RXFVIIJJSA-N |
| XLogP | 2.79 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|