C34H42O9S — CID 10484096
[2-(benzenesulfonyl)-1-[(2S,3R,4R,5R,6R)-5,6-dimethoxy-3,4-bis(phenylmethoxy)oxan-2-yl]-3-methylbutyl] acetate (PubChem CID 10484096) has the molecular formula C34H42O9S and a molecular weight of 626.77 g/mol. Its IUPAC name is [2-(benzenesulfonyl)-1-[(2S,3R,4R,5R,6R)-5,6-dimethoxy-3,4-bis(phenylmethoxy)oxan-2-yl]-3-methylbutyl] acetate.
| Compound Name | [2-(benzenesulfonyl)-1-[(2S,3R,4R,5R,6R)-5,6-dimethoxy-3,4-bis(phenylmethoxy)oxan-2-yl]-3-methylbutyl] acetate |
|---|---|
| PubChem CID | 10484096 |
| Molecular Formula | C34H42O9S |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 626.25 |
| IUPAC Name | [2-(benzenesulfonyl)-1-[(2S,3R,4R,5R,6R)-5,6-dimethoxy-3,4-bis(phenylmethoxy)oxan-2-yl]-3-methylbutyl] acetate |
| SMILES | CO[C@@H]1O[C@H](C(OC(C)=O)C(C(C)C)S(=O)(=O)c2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OC |
| InChI | InChI=1S/C34H42O9S/c1-23(2)33(44(36,37)27-19-13-8-14-20-27)31(42-24(3)35)30-28(40-21-25-15-9-6-10-16-25)29(32(38-4)34(39-5)43-30)41-22-26-17-11-7-12-18-26/h6-20,23,28-34H,21-22H2,1-5H3/t28-,29-,30+,31?,32-,33?,34-/m1/s1 |
| InChIKey | GSQYZIIMCZUPPV-IHOAYYRMSA-N |
| XLogP | 4.97 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |