C23H25NO6S — CID 72696681
(2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxamide (PubChem CID 72696681) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is (2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxamide.
| Compound Name | (2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxamide |
|---|---|
| PubChem CID | 72696681 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | (2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxamide |
| SMILES | CC1=C(C(N)=O)[C@@H]2[C@H](O1)O[C@H](COCc1ccccc1)[C@H]2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H25NO6S/c1-14-8-10-17(11-9-14)31(26,27)21-18(13-28-12-16-6-4-3-5-7-16)30-23-20(21)19(22(24)25)15(2)29-23/h3-11,18,20-21,23H,12-13H2,1-2H3,(H2,24,25)/t18-,20+,21-,23-/m1/s1 |
| InChIKey | SYKMKOPRKJEBIQ-ZVXPMLRVSA-N |
| XLogP | 2.48 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |