C27H30O6S — CID 72696684
(1S,2R,3aS,8bR)-6,6-dimethyl-1-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-1,2,3a,5,7,8b-hexahydrofuro[2,3-b][1]benzofuran-8-one (PubChem CID 72696684) has the molecular formula C27H30O6S and a molecular weight of 482.60 g/mol. Its IUPAC name is (1S,2R,3aS,8bR)-6,6-dimethyl-1-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-1,2,3a,5,7,8b-hexahydrofuro[2,3-b][1]benzofuran-8-one.
| Compound Name | (1S,2R,3aS,8bR)-6,6-dimethyl-1-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-1,2,3a,5,7,8b-hexahydrofuro[2,3-b][1]benzofuran-8-one |
|---|---|
| PubChem CID | 72696684 |
| Molecular Formula | C27H30O6S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | (1S,2R,3aS,8bR)-6,6-dimethyl-1-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-1,2,3a,5,7,8b-hexahydrofuro[2,3-b][1]benzofuran-8-one |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2[C@@H]3C4=C(CC(C)(C)CC4=O)O[C@@H]3O[C@@H]2COCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H30O6S/c1-17-9-11-19(12-10-17)34(29,30)25-22(16-31-15-18-7-5-4-6-8-18)33-26-24(25)23-20(28)13-27(2,3)14-21(23)32-26/h4-12,22,24-26H,13-16H2,1-3H3/t22-,24+,25-,26-/m1/s1 |
| InChIKey | UIXZKOZZSHAXLU-BIGMCNFVSA-N |
| XLogP | 4.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |