C26H32O8S — CID 16743485
methyl (3S)-3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(4-methylphenyl)sulfonylbutanoate (PubChem CID 16743485) has the molecular formula C26H32O8S and a molecular weight of 504.60 g/mol. Its IUPAC name is methyl (3S)-3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(4-methylphenyl)sulfonylbutanoate.
| Compound Name | methyl (3S)-3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(4-methylphenyl)sulfonylbutanoate |
|---|---|
| PubChem CID | 16743485 |
| Molecular Formula | C26H32O8S |
| Molecular Weight | 504.60 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | methyl (3S)-3-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(4-methylphenyl)sulfonylbutanoate |
| SMILES | COC(=O)C[C@H](CS(=O)(=O)c1ccc(C)cc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H32O8S/c1-17-10-12-20(13-11-17)35(28,29)16-19(14-21(27)30-4)22-23(31-15-18-8-6-5-7-9-18)24-25(32-22)34-26(2,3)33-24/h5-13,19,22-25H,14-16H2,1-4H3/t19-,22-,23-,24-,25-/m1/s1 |
| InChIKey | KKEGUFQKMRBMLZ-XXLKIAMFSA-N |
| XLogP | 3.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |