C25H28O10S — CID 570513
[2-(6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(4-methylphenyl)sulfonyloxyethyl] benzoate (PubChem CID 570513) has the molecular formula C25H28O10S and a molecular weight of 520.56 g/mol. Its IUPAC name is [2-(6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(4-methylphenyl)sulfonyloxyethyl] benzoate.
| Compound Name | [2-(6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(4-methylphenyl)sulfonyloxyethyl] benzoate |
|---|---|
| PubChem CID | 570513 |
| Molecular Formula | C25H28O10S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [2-(6-acetyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl)-2-(4-methylphenyl)sulfonyloxyethyl] benzoate |
| SMILES | CC(=O)OC1C(C(COC(=O)c2ccccc2)OS(=O)(=O)c2ccc(C)cc2)OC2OC(C)(C)OC21 |
| InChI | InChI=1S/C25H28O10S/c1-15-10-12-18(13-11-15)36(28,29)35-19(14-30-23(27)17-8-6-5-7-9-17)20-21(31-16(2)26)22-24(32-20)34-25(3,4)33-22/h5-13,19-22,24H,14H2,1-4H3 |
| InChIKey | FWCLUCLZUHIZSN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|