C22H26O7S — CID 11618925
[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate (PubChem CID 11618925) has the molecular formula C22H26O7S and a molecular weight of 434.51 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11618925 |
| Molecular Formula | C22H26O7S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H26O7S/c1-15-9-11-17(12-10-15)30(23,24)26-14-18-19(25-13-16-7-5-4-6-8-16)20-21(27-18)29-22(2,3)28-20/h4-12,18-21H,13-14H2,1-3H3/t18-,19+,20-,21-/m1/s1 |
| InChIKey | USEPKWIFYVGUCA-PLACYPQZSA-N |
| XLogP | 3.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|