C18H20O8S — CID 15958337
[(7R,12R)-3,3-dimethyl-10,10-dioxo-2,4,11,13-tetraoxa-10λ6-thiadispiro[4.1.47.25]tridec-8-en-12-yl]methyl benzoate (PubChem CID 15958337) has the molecular formula C18H20O8S and a molecular weight of 396.42 g/mol. Its IUPAC name is [(7R,12R)-3,3-dimethyl-10,10-dioxo-2,4,11,13-tetraoxa-10λ6-thiadispiro[4.1.47.25]tridec-8-en-12-yl]methyl benzoate.
| Compound Name | [(7R,12R)-3,3-dimethyl-10,10-dioxo-2,4,11,13-tetraoxa-10λ6-thiadispiro[4.1.47.25]tridec-8-en-12-yl]methyl benzoate |
|---|---|
| PubChem CID | 15958337 |
| Molecular Formula | C18H20O8S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [(7R,12R)-3,3-dimethyl-10,10-dioxo-2,4,11,13-tetraoxa-10λ6-thiadispiro[4.1.47.25]tridec-8-en-12-yl]methyl benzoate |
| SMILES | CC1(C)OCC2(C[C@@]3(C=CS(=O)(=O)O3)[C@@H](COC(=O)c3ccccc3)O2)O1 |
| InChI | InChI=1S/C18H20O8S/c1-16(2)23-12-18(25-16)11-17(8-9-27(20,21)26-17)14(24-18)10-22-15(19)13-6-4-3-5-7-13/h3-9,14H,10-12H2,1-2H3/t14-,17+,18?/m1/s1 |
| InChIKey | WPILEZJPCYGEKQ-NAVMLSPISA-N |
| XLogP | 1.72 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|