C20H28O8S — CID 139090940
methyl (3R)-3-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(4-methylphenyl)sulfonylbutanoate (PubChem CID 139090940) has the molecular formula C20H28O8S and a molecular weight of 428.50 g/mol. Its IUPAC name is methyl (3R)-3-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(4-methylphenyl)sulfonylbutanoate.
| Compound Name | methyl (3R)-3-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(4-methylphenyl)sulfonylbutanoate |
|---|---|
| PubChem CID | 139090940 |
| Molecular Formula | C20H28O8S |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | methyl (3R)-3-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-4-(4-methylphenyl)sulfonylbutanoate |
| SMILES | COC(=O)C[C@@H](CS(=O)(=O)c1ccc(C)cc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C20H28O8S/c1-12-6-8-14(9-7-12)29(22,23)11-13(10-15(21)24-4)16-17(25-5)18-19(26-16)28-20(2,3)27-18/h6-9,13,16-19H,10-11H2,1-5H3/t13-,16+,17-,18+,19+/m0/s1 |
| InChIKey | OGCDWDJMITYFEH-ZNLIYNOOSA-N |
| XLogP | 1.84 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |