C17H22O7S — CID 176521882
[(3aR,4S,6R,6aR)-2,2-dimethyl-4-(4-methylphenyl)sulfonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 176521882) has the molecular formula C17H22O7S and a molecular weight of 370.42 g/mol. Its IUPAC name is [(3aR,4S,6R,6aR)-2,2-dimethyl-4-(4-methylphenyl)sulfonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [(3aR,4S,6R,6aR)-2,2-dimethyl-4-(4-methylphenyl)sulfonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 176521882 |
| Molecular Formula | C17H22O7S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | [(3aR,4S,6R,6aR)-2,2-dimethyl-4-(4-methylphenyl)sulfonyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](S(=O)(=O)c2ccc(C)cc2)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C17H22O7S/c1-10-5-7-12(8-6-10)25(19,20)16-15-14(23-17(3,4)24-15)13(22-16)9-21-11(2)18/h5-8,13-16H,9H2,1-4H3/t13-,14-,15-,16+/m1/s1 |
| InChIKey | IZHKKQUTWFGJMK-FPCVCCKLSA-N |
| XLogP | 1.58 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |