C16H20O4S — CID 15946913
(1R,2S,4S,5R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(4-methylphenyl)sulfanyl-3,6-dioxabicyclo[3.1.0]hexane (PubChem CID 15946913) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is (1R,2S,4S,5R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(4-methylphenyl)sulfanyl-3,6-dioxabicyclo[3.1.0]hexane.
| Compound Name | (1R,2S,4S,5R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(4-methylphenyl)sulfanyl-3,6-dioxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 15946913 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (1R,2S,4S,5R)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-(4-methylphenyl)sulfanyl-3,6-dioxabicyclo[3.1.0]hexane |
| SMILES | Cc1ccc(S[C@@H]2O[C@@H]([C@H]3COC(C)(C)O3)[C@H]3O[C@H]32)cc1 |
| InChI | InChI=1S/C16H20O4S/c1-9-4-6-10(7-5-9)21-15-14-13(18-14)12(19-15)11-8-17-16(2,3)20-11/h4-7,11-15H,8H2,1-3H3/t11-,12+,13-,14-,15+/m1/s1 |
| InChIKey | NXCHVLDRZHGWHI-KHMAMNHCSA-N |
| XLogP | 2.73 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|