C23H26O6S — CID 134931690
S-phenyl (2S)-2-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanethioate (PubChem CID 134931690) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is S-phenyl (2S)-2-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanethioate.
| Compound Name | S-phenyl (2S)-2-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanethioate |
|---|---|
| PubChem CID | 134931690 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | S-phenyl (2S)-2-[(3aR,4R,6S,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-phenylmethoxyethanethioate |
| SMILES | CO[C@@H]1O[C@H]([C@H](OCc2ccccc2)C(=O)Sc2ccccc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C23H26O6S/c1-23(2)28-18-17(27-22(25-3)20(18)29-23)19(26-14-15-10-6-4-7-11-15)21(24)30-16-12-8-5-9-13-16/h4-13,17-20,22H,14H2,1-3H3/t17-,18+,19-,20+,22+/m0/s1 |
| InChIKey | QPLQYMLKGHHTGX-DNVBULBTSA-N |
| XLogP | 3.78 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|