C27H26O6 — CID 135017911
(3R,4S,5R)-5-(2-phenyl-1,3-dioxolan-4-yl)-3,4-bis(phenylmethoxy)oxolan-2-one (PubChem CID 135017911) has the molecular formula C27H26O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is (3R,4S,5R)-5-(2-phenyl-1,3-dioxolan-4-yl)-3,4-bis(phenylmethoxy)oxolan-2-one.
| Compound Name | (3R,4S,5R)-5-(2-phenyl-1,3-dioxolan-4-yl)-3,4-bis(phenylmethoxy)oxolan-2-one |
|---|---|
| PubChem CID | 135017911 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | (3R,4S,5R)-5-(2-phenyl-1,3-dioxolan-4-yl)-3,4-bis(phenylmethoxy)oxolan-2-one |
| SMILES | O=C1O[C@H](C2COC(c3ccccc3)O2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H26O6/c28-26-25(30-17-20-12-6-2-7-13-20)24(29-16-19-10-4-1-5-11-19)23(33-26)22-18-31-27(32-22)21-14-8-3-9-15-21/h1-15,22-25,27H,16-18H2/t22?,23-,24+,25-,27?/m1/s1 |
| InChIKey | FLQSDJBBOLSYSM-SSUJOWACSA-N |
| XLogP | 4.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |