C16H20O5 — CID 134852530
(3aS,4R,6R,6aS)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carbaldehyde (PubChem CID 134852530) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is (3aS,4R,6R,6aS)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carbaldehyde.
| Compound Name | (3aS,4R,6R,6aS)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 134852530 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | (3aS,4R,6R,6aS)-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-4-carbaldehyde |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](C=O)O[C@@H]2COCc1ccccc1 |
| InChI | InChI=1S/C16H20O5/c1-16(2)20-14-12(8-17)19-13(15(14)21-16)10-18-9-11-6-4-3-5-7-11/h3-8,12-15H,9-10H2,1-2H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | MMAOKCXXKDIWID-YJNKXOJESA-N |
| XLogP | 1.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|