C19H24O7 — CID 135009456
methyl 2-[(3aS,6R,6aR)-4-acetyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate (PubChem CID 135009456) has the molecular formula C19H24O7 and a molecular weight of 364.39 g/mol. Its IUPAC name is methyl 2-[(3aS,6R,6aR)-4-acetyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate.
| Compound Name | methyl 2-[(3aS,6R,6aR)-4-acetyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate |
|---|---|
| PubChem CID | 135009456 |
| Molecular Formula | C19H24O7 |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | methyl 2-[(3aS,6R,6aR)-4-acetyl-2,2-dimethyl-6-phenylmethoxy-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate |
| SMILES | COC(=O)CC1(C(C)=O)O[C@@H](OCc2ccccc2)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C19H24O7/c1-12(20)19(10-14(21)22-4)16-15(24-18(2,3)25-16)17(26-19)23-11-13-8-6-5-7-9-13/h5-9,15-17H,10-11H2,1-4H3/t15-,16+,17-,19?/m1/s1 |
| InChIKey | STRATNCKNMWGDK-KZCXMXTOSA-N |
| XLogP | 1.97 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |