C24H28O7S — CID 16743145
2-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-methylphenyl)sulfonylpropanal (PubChem CID 16743145) has the molecular formula C24H28O7S and a molecular weight of 460.55 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-methylphenyl)sulfonylpropanal.
| Compound Name | 2-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-methylphenyl)sulfonylpropanal |
|---|---|
| PubChem CID | 16743145 |
| Molecular Formula | C24H28O7S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 2-[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-(4-methylphenyl)sulfonylpropanal |
| SMILES | Cc1ccc(S(=O)(=O)CC(C=O)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H28O7S/c1-16-9-11-19(12-10-16)32(26,27)15-18(13-25)20-21(28-14-17-7-5-4-6-8-17)22-23(29-20)31-24(2,3)30-22/h4-13,18,20-23H,14-15H2,1-3H3/t18?,20-,21-,22-,23-/m1/s1 |
| InChIKey | AZABWDUIEOEQDG-JADQAENNSA-N |
| XLogP | 3.05 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|