C23H26O6S — CID 11396298
(3aS,5S,6S,6aS)-5-[(E)-3-(benzenesulfonyl)prop-1-enyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 11396298) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is (3aS,5S,6S,6aS)-5-[(E)-3-(benzenesulfonyl)prop-1-enyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aS,5S,6S,6aS)-5-[(E)-3-(benzenesulfonyl)prop-1-enyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 11396298 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (3aS,5S,6S,6aS)-5-[(E)-3-(benzenesulfonyl)prop-1-enyl]-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@@H]2O[C@@H](/C=C/CS(=O)(=O)c3ccccc3)[C@H](OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C23H26O6S/c1-23(2)28-21-20(26-16-17-10-5-3-6-11-17)19(27-22(21)29-23)14-9-15-30(24,25)18-12-7-4-8-13-18/h3-14,19-22H,15-16H2,1-2H3/b14-9+/t19-,20-,21-,22-/m0/s1 |
| InChIKey | OXFUEVIHFSWBDM-YQWRJGCASA-N |
| XLogP | 3.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|