C23H26O6S — CID 11590056
(3aR,5R,6S,6aR)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfonylethenyl]-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 11590056) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfonylethenyl]-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfonylethenyl]-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 11590056 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (3aR,5R,6S,6aR)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfonylethenyl]-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | Cc1ccc(S(=O)(=O)/C=C/[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H26O6S/c1-16-9-11-18(12-10-16)30(24,25)14-13-19-20(26-15-17-7-5-4-6-8-17)21-22(27-19)29-23(2,3)28-21/h4-14,19-22H,15H2,1-3H3/b14-13+/t19-,20+,21-,22-/m1/s1 |
| InChIKey | GSRGECPGPKFSBY-COWZSFORSA-N |
| XLogP | 3.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |