C20H23FO6S — CID 87728337
[(2S,3R,4S,5R)-4-fluoro-2-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate (PubChem CID 87728337) has the molecular formula C20H23FO6S and a molecular weight of 410.46 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-4-fluoro-2-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3R,4S,5R)-4-fluoro-2-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87728337 |
| Molecular Formula | C20H23FO6S |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | [(2S,3R,4S,5R)-4-fluoro-2-methoxy-5-(phenylmethoxymethyl)oxolan-3-yl] 4-methylbenzenesulfonate |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@H](F)[C@@H]1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H23FO6S/c1-14-8-10-16(11-9-14)28(22,23)27-19-18(21)17(26-20(19)24-2)13-25-12-15-6-4-3-5-7-15/h3-11,17-20H,12-13H2,1-2H3/t17-,18+,19+,20+/m1/s1 |
| InChIKey | VFDARUHLXBMNSL-FYQPLNBISA-N |
| XLogP | 3.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|