C25H28O7S — CID 72696553
ethyl (2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate (PubChem CID 72696553) has the molecular formula C25H28O7S and a molecular weight of 472.56 g/mol. Its IUPAC name is ethyl (2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate.
| Compound Name | ethyl (2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
|---|---|
| PubChem CID | 72696553 |
| Molecular Formula | C25H28O7S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | ethyl (2R,3S,3aR,6aS)-5-methyl-3-(4-methylphenyl)sulfonyl-2-(phenylmethoxymethyl)-2,3,3a,6a-tetrahydrofuro[2,3-b]furan-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)O[C@@H]2O[C@H](COCc3ccccc3)[C@@H](S(=O)(=O)c3ccc(C)cc3)[C@H]12 |
| InChI | InChI=1S/C25H28O7S/c1-4-30-24(26)21-17(3)31-25-22(21)23(33(27,28)19-12-10-16(2)11-13-19)20(32-25)15-29-14-18-8-6-5-7-9-18/h5-13,20,22-23,25H,4,14-15H2,1-3H3/t20-,22+,23-,25-/m1/s1 |
| InChIKey | PZXSGADGFRRWNB-JVICHNFNSA-N |
| XLogP | 3.56 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |