C49H76O8S — CID 11115501
[4-(benzenesulfonyl)-6-[(4R,5R)-5-dec-9-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4R,5R)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]hexan-3-yl] benzoate (PubChem CID 11115501) has the molecular formula C49H76O8S and a molecular weight of 825.21 g/mol. Its IUPAC name is [4-(benzenesulfonyl)-6-[(4R,5R)-5-dec-9-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4R,5R)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]hexan-3-yl] benzoate.
| Compound Name | [4-(benzenesulfonyl)-6-[(4R,5R)-5-dec-9-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4R,5R)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]hexan-3-yl] benzoate |
|---|---|
| PubChem CID | 11115501 |
| Molecular Formula | C49H76O8S |
| Molecular Weight | 825.21 g/mol |
| Exact Mass | 824.53 |
| IUPAC Name | [4-(benzenesulfonyl)-6-[(4R,5R)-5-dec-9-enyl-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(4R,5R)-5-decyl-2,2-dimethyl-1,3-dioxolan-4-yl]hexan-3-yl] benzoate |
| SMILES | C=CCCCCCCCC[C@H]1OC(C)(C)O[C@@H]1CCC(C(CC[C@H]1OC(C)(C)O[C@@H]1CCCCCCCCCC)OC(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C49H76O8S/c1-7-9-11-13-15-17-19-27-33-41-43(56-48(3,4)54-41)35-36-45(53-47(50)39-29-23-21-24-30-39)46(58(51,52)40-31-25-22-26-32-40)38-37-44-42(55-49(5,6)57-44)34-28-20-18-16-14-12-10-8-2/h8,21-26,29-32,41-46H,2,7,9-20,27-28,33-38H2,1,3-6H3/t41-,42-,43-,44-,45?,46?/m1/s1 |
| InChIKey | UQZQXMROTCTNLY-MHZLZZOESA-N |
| XLogP | 12.49 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.21 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|