C25H28F2O6S — CID 102147600
[(2S)-2-acetylsulfanyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-difluoro-4-phenylmethoxybutyl] benzoate (PubChem CID 102147600) has the molecular formula C25H28F2O6S and a molecular weight of 494.56 g/mol. Its IUPAC name is [(2S)-2-acetylsulfanyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-difluoro-4-phenylmethoxybutyl] benzoate.
| Compound Name | [(2S)-2-acetylsulfanyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-difluoro-4-phenylmethoxybutyl] benzoate |
|---|---|
| PubChem CID | 102147600 |
| Molecular Formula | C25H28F2O6S |
| Molecular Weight | 494.56 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | [(2S)-2-acetylsulfanyl-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,3-difluoro-4-phenylmethoxybutyl] benzoate |
| SMILES | CC(=O)S[C@@H](COC(=O)c1ccccc1)C(F)(F)C(OCc1ccccc1)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C25H28F2O6S/c1-17(28)34-21(16-31-23(29)19-12-8-5-9-13-19)25(26,27)22(20-15-32-24(2,3)33-20)30-14-18-10-6-4-7-11-18/h4-13,20-22H,14-16H2,1-3H3/t20-,21+,22?/m1/s1 |
| InChIKey | QWYKSLOUIBIDBI-LKXRKSRJSA-N |
| XLogP | 4.86 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|