C21H24O7S — CID 14523042
[(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-methylphenyl)sulfonyloxyethyl] benzoate (PubChem CID 14523042) has the molecular formula C21H24O7S and a molecular weight of 420.48 g/mol. Its IUPAC name is [(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-methylphenyl)sulfonyloxyethyl] benzoate.
| Compound Name | [(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-methylphenyl)sulfonyloxyethyl] benzoate |
|---|---|
| PubChem CID | 14523042 |
| Molecular Formula | C21H24O7S |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [(2S)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(4-methylphenyl)sulfonyloxyethyl] benzoate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H](COC(=O)c2ccccc2)[C@@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C21H24O7S/c1-15-9-11-17(12-10-15)29(23,24)28-19(18-14-26-21(2,3)27-18)13-25-20(22)16-7-5-4-6-8-16/h4-12,18-19H,13-14H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | ZHFVHYFXTBRGHA-OALUTQOASA-N |
| XLogP | 3.08 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|