C28H30O8S — CID 15405993
[2-(benzenesulfonyl)-4,4,5-trimethoxy-2-methyl-5-oxo-1-phenylpentyl] benzoate (PubChem CID 15405993) has the molecular formula C28H30O8S and a molecular weight of 526.61 g/mol. Its IUPAC name is [2-(benzenesulfonyl)-4,4,5-trimethoxy-2-methyl-5-oxo-1-phenylpentyl] benzoate.
| Compound Name | [2-(benzenesulfonyl)-4,4,5-trimethoxy-2-methyl-5-oxo-1-phenylpentyl] benzoate |
|---|---|
| PubChem CID | 15405993 |
| Molecular Formula | C28H30O8S |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | [2-(benzenesulfonyl)-4,4,5-trimethoxy-2-methyl-5-oxo-1-phenylpentyl] benzoate |
| SMILES | COC(=O)C(CC(C)(C(OC(=O)c1ccccc1)c1ccccc1)S(=O)(=O)c1ccccc1)(OC)OC |
| InChI | InChI=1S/C28H30O8S/c1-27(20-28(34-3,35-4)26(30)33-2,37(31,32)23-18-12-7-13-19-23)24(21-14-8-5-9-15-21)36-25(29)22-16-10-6-11-17-22/h5-19,24H,20H2,1-4H3 |
| InChIKey | HXPFYMIAKUQCOE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|