C32H30O10S — CID 16742688
methyl (2S,3S,4S,5R,6S)-4,5-dibenzoyloxy-3-(4-oxopentanoyloxy)-6-phenylsulfanyloxane-2-carboxylate (PubChem CID 16742688) has the molecular formula C32H30O10S and a molecular weight of 606.65 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-4,5-dibenzoyloxy-3-(4-oxopentanoyloxy)-6-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-4,5-dibenzoyloxy-3-(4-oxopentanoyloxy)-6-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 16742688 |
| Molecular Formula | C32H30O10S |
| Molecular Weight | 606.65 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-4,5-dibenzoyloxy-3-(4-oxopentanoyloxy)-6-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Sc2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)CCC(C)=O |
| InChI | InChI=1S/C32H30O10S/c1-20(33)18-19-24(34)39-25-26(40-29(35)21-12-6-3-7-13-21)28(41-30(36)22-14-8-4-9-15-22)32(42-27(25)31(37)38-2)43-23-16-10-5-11-17-23/h3-17,25-28,32H,18-19H2,1-2H3/t25-,26-,27-,28+,32-/m0/s1 |
| InChIKey | USCBMRXNVKKDRZ-JDBQAIRESA-N |
| XLogP | 4.41 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.65 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|