C26H34O6S — CID 11113509
1-[(1R,2R,4S)-4-(2-methoxyethoxymethoxy)-2-(phenylmethoxymethyl)cyclopentyl]-2-[(R)-(4-methylphenyl)sulfinyl]ethanone (PubChem CID 11113509) has the molecular formula C26H34O6S and a molecular weight of 474.62 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-4-(2-methoxyethoxymethoxy)-2-(phenylmethoxymethyl)cyclopentyl]-2-[(R)-(4-methylphenyl)sulfinyl]ethanone.
| Compound Name | 1-[(1R,2R,4S)-4-(2-methoxyethoxymethoxy)-2-(phenylmethoxymethyl)cyclopentyl]-2-[(R)-(4-methylphenyl)sulfinyl]ethanone |
|---|---|
| PubChem CID | 11113509 |
| Molecular Formula | C26H34O6S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 1-[(1R,2R,4S)-4-(2-methoxyethoxymethoxy)-2-(phenylmethoxymethyl)cyclopentyl]-2-[(R)-(4-methylphenyl)sulfinyl]ethanone |
| SMILES | COCCOCO[C@H]1C[C@@H](COCc2ccccc2)[C@H](C(=O)C[S@@](=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C26H34O6S/c1-20-8-10-24(11-9-20)33(28)18-26(27)25-15-23(32-19-30-13-12-29-2)14-22(25)17-31-16-21-6-4-3-5-7-21/h3-11,22-23,25H,12-19H2,1-2H3/t22-,23-,25+,33+/m0/s1 |
| InChIKey | FCXOWNDFAOJGSI-WSZHPKKKSA-N |
| XLogP | 3.92 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|