C28H34O10S — CID 16744016
dimethyl 2-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propanedioate (PubChem CID 16744016) has the molecular formula C28H34O10S and a molecular weight of 562.64 g/mol. Its IUPAC name is dimethyl 2-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propanedioate.
| Compound Name | dimethyl 2-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propanedioate |
|---|---|
| PubChem CID | 16744016 |
| Molecular Formula | C28H34O10S |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.19 |
| IUPAC Name | dimethyl 2-[(1R)-1-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](CS(=O)(=O)c1ccc(C)cc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H34O10S/c1-17-11-13-19(14-12-17)39(31,32)16-20(21(25(29)33-4)26(30)34-5)22-23(35-15-18-9-7-6-8-10-18)24-27(36-22)38-28(2,3)37-24/h6-14,20-24,27H,15-16H2,1-5H3/t20-,22-,23+,24-,27-/m1/s1 |
| InChIKey | VBDJMCIJRWCAKX-UFOFBUIZSA-N |
| XLogP | 2.81 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|