C22H30O10S — CID 16743142
dimethyl 2-[(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propanedioate (PubChem CID 16743142) has the molecular formula C22H30O10S and a molecular weight of 486.54 g/mol. Its IUPAC name is dimethyl 2-[(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propanedioate.
| Compound Name | dimethyl 2-[(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propanedioate |
|---|---|
| PubChem CID | 16743142 |
| Molecular Formula | C22H30O10S |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | dimethyl 2-[(1R)-1-[(3aR,5R,6S,6aR)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-(4-methylphenyl)sulfonylethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](CS(=O)(=O)c1ccc(C)cc1)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OC |
| InChI | InChI=1S/C22H30O10S/c1-12-7-9-13(10-8-12)33(25,26)11-14(15(19(23)28-5)20(24)29-6)16-17(27-4)18-21(30-16)32-22(2,3)31-18/h7-10,14-18,21H,11H2,1-6H3/t14-,16-,17+,18-,21-/m1/s1 |
| InChIKey | SBNZOJBEZIQMJM-YUZRNDJPSA-N |
| XLogP | 1.24 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|