C21H22O10S2 — CID 152749913
[(2R,3S,3aS,6S,6aS)-3-hydroxy-2-methoxy-3-(4-methylphenyl)sulfonyl-5-oxo-2,3a,6,6a-tetrahydrofuro[3,2-b]furan-6-yl] 4-methylbenzenesulfonate (PubChem CID 152749913) has the molecular formula C21H22O10S2 and a molecular weight of 498.53 g/mol. Its IUPAC name is [(2R,3S,3aS,6S,6aS)-3-hydroxy-2-methoxy-3-(4-methylphenyl)sulfonyl-5-oxo-2,3a,6,6a-tetrahydrofuro[3,2-b]furan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S,3aS,6S,6aS)-3-hydroxy-2-methoxy-3-(4-methylphenyl)sulfonyl-5-oxo-2,3a,6,6a-tetrahydrofuro[3,2-b]furan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 152749913 |
| Molecular Formula | C21H22O10S2 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [(2R,3S,3aS,6S,6aS)-3-hydroxy-2-methoxy-3-(4-methylphenyl)sulfonyl-5-oxo-2,3a,6,6a-tetrahydrofuro[3,2-b]furan-6-yl] 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1O[C@@H]2[C@H](OS(=O)(=O)c3ccc(C)cc3)C(=O)O[C@@H]2[C@]1(O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H22O10S2/c1-12-4-8-14(9-5-12)32(24,25)21(23)18-16(29-20(21)28-3)17(19(22)30-18)31-33(26,27)15-10-6-13(2)7-11-15/h4-11,16-18,20,23H,1-3H3/t16-,17+,18+,20-,21+/m1/s1 |
| InChIKey | JKZKTMCWMAPTLN-QBVCYTKMSA-N |
| XLogP | 0.84 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|