C25H30O8S — CID 56633095
1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione (PubChem CID 56633095) has the molecular formula C25H30O8S and a molecular weight of 490.57 g/mol. Its IUPAC name is 1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione.
| Compound Name | 1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 56633095 |
| Molecular Formula | C25H30O8S |
| Molecular Weight | 490.57 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-phenylpropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione |
| SMILES | Cc1ccc(S(O)(O)C(=O)C(=O)[C@H]2O[C@H](OCCCc3ccccc3)[C@H]3OC(C)(C)O[C@H]32)cc1 |
| InChI | InChI=1S/C25H30O8S/c1-16-11-13-18(14-12-16)34(28,29)23(27)19(26)20-21-22(33-25(2,3)32-21)24(31-20)30-15-7-10-17-8-5-4-6-9-17/h4-6,8-9,11-14,20-22,24,28-29H,7,10,15H2,1-3H3/t20-,21+,22+,24+/m1/s1 |
| InChIKey | AZIDIVILSKHNLU-VCHRRKICSA-N |
| XLogP | 4.09 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|