C28H44O9S — CID 56628744
1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione (PubChem CID 56628744) has the molecular formula C28H44O9S and a molecular weight of 556.72 g/mol. Its IUPAC name is 1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione.
| Compound Name | 1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione |
|---|---|
| PubChem CID | 56628744 |
| Molecular Formula | C28H44O9S |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 1-[(3aS,4S,6S,6aR)-2,2-dimethyl-4-(3-nonoxypropoxy)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-2-[dihydroxy-(4-methylphenyl)-λ4-sulfanyl]ethane-1,2-dione |
| SMILES | CCCCCCCCCOCCCO[C@H]1O[C@H](C(=O)C(=O)S(O)(O)c2ccc(C)cc2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C28H44O9S/c1-5-6-7-8-9-10-11-17-33-18-12-19-34-27-25-24(36-28(3,4)37-25)23(35-27)22(29)26(30)38(31,32)21-15-13-20(2)14-16-21/h13-16,23-25,27,31-32H,5-12,17-19H2,1-4H3/t23-,24+,25+,27+/m1/s1 |
| InChIKey | SNLJILWWYOTGAK-AQCTUAEDSA-N |
| XLogP | 5.62 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|