C20H28O7S — CID 101205340
1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(4-methylphenyl)sulfonylpropan-1-one (PubChem CID 101205340) has the molecular formula C20H28O7S and a molecular weight of 412.50 g/mol. Its IUPAC name is 1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(4-methylphenyl)sulfonylpropan-1-one.
| Compound Name | 1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(4-methylphenyl)sulfonylpropan-1-one |
|---|---|
| PubChem CID | 101205340 |
| Molecular Formula | C20H28O7S |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 1-[(4S,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(4-methylphenyl)sulfonylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)CCC(=O)[C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H28O7S/c1-13-6-8-14(9-7-13)28(22,23)11-10-15(21)17-18(27-20(4,5)26-17)16-12-24-19(2,3)25-16/h6-9,16-18H,10-12H2,1-5H3/t16-,17-,18-/m1/s1 |
| InChIKey | CSRFGQRBLOOHMS-KZNAEPCWSA-N |
| XLogP | 2.40 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |